C17H22FNO4 — CID 97485402
1-[(3aS,7R,7aS)-7-methoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl]-2-(4-fluoro-2-methoxyphenyl)ethanone (PubChem CID 97485402) has the molecular formula C17H22FNO4 and a molecular weight of 323.36 g/mol. Its IUPAC name is 1-[(3aS,7R,7aS)-7-methoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl]-2-(4-fluoro-2-methoxyphenyl)ethanone.
| Compound Name | 1-[(3aS,7R,7aS)-7-methoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl]-2-(4-fluoro-2-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 97485402 |
| Molecular Formula | C17H22FNO4 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 1-[(3aS,7R,7aS)-7-methoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl]-2-(4-fluoro-2-methoxyphenyl)ethanone |
| SMILES | COc1cc(F)ccc1CC(=O)N1CC[C@@H](OC)[C@H]2OCC[C@@H]21 |
| InChI | InChI=1S/C17H22FNO4/c1-21-14-5-7-19(13-6-8-23-17(13)14)16(20)9-11-3-4-12(18)10-15(11)22-2/h3-4,10,13-14,17H,5-9H2,1-2H3/t13-,14+,17-/m0/s1 |
| InChIKey | XLZHTPJVTBLGJV-VBQJREDUSA-N |
| XLogP | 1.78 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |