C19H26FNO4 — CID 131660498
1-[4a-(methoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-2-(4-fluoro-2-methoxyphenyl)ethanone (PubChem CID 131660498) has the molecular formula C19H26FNO4 and a molecular weight of 351.42 g/mol. Its IUPAC name is 1-[4a-(methoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-2-(4-fluoro-2-methoxyphenyl)ethanone.
| Compound Name | 1-[4a-(methoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-2-(4-fluoro-2-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 131660498 |
| Molecular Formula | C19H26FNO4 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 1-[4a-(methoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-2-(4-fluoro-2-methoxyphenyl)ethanone |
| SMILES | COCC12CCCOC1CCN(C(=O)Cc1ccc(F)cc1OC)C2 |
| InChI | InChI=1S/C19H26FNO4/c1-23-13-19-7-3-9-25-17(19)6-8-21(12-19)18(22)10-14-4-5-15(20)11-16(14)24-2/h4-5,11,17H,3,6-10,12-13H2,1-2H3 |
| InChIKey | HKZJXSSTOLBPSG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |