C18H24ClNO4 — CID 131660294
[4a-(methoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-(3-chloro-4-methoxyphenyl)methanone (PubChem CID 131660294) has the molecular formula C18H24ClNO4 and a molecular weight of 353.85 g/mol. Its IUPAC name is [4a-(methoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-(3-chloro-4-methoxyphenyl)methanone.
| Compound Name | [4a-(methoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-(3-chloro-4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 131660294 |
| Molecular Formula | C18H24ClNO4 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | [4a-(methoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-(3-chloro-4-methoxyphenyl)methanone |
| SMILES | COCC12CCCOC1CCN(C(=O)c1ccc(OC)c(Cl)c1)C2 |
| InChI | InChI=1S/C18H24ClNO4/c1-22-12-18-7-3-9-24-16(18)6-8-20(11-18)17(21)13-4-5-15(23-2)14(19)10-13/h4-5,10,16H,3,6-9,11-12H2,1-2H3 |
| InChIKey | RVINQRQFFCNROJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |