C18H23NO5 — CID 97363072
[(4aS,8aR)-4a-(methoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-(1,3-benzodioxol-5-yl)methanone (PubChem CID 97363072) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is [(4aS,8aR)-4a-(methoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-(1,3-benzodioxol-5-yl)methanone.
| Compound Name | [(4aS,8aR)-4a-(methoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-(1,3-benzodioxol-5-yl)methanone |
|---|---|
| PubChem CID | 97363072 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | [(4aS,8aR)-4a-(methoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-(1,3-benzodioxol-5-yl)methanone |
| SMILES | COC[C@@]12CCCO[C@@H]1CCN(C(=O)c1ccc3c(c1)OCO3)C2 |
| InChI | InChI=1S/C18H23NO5/c1-21-11-18-6-2-8-22-16(18)5-7-19(10-18)17(20)13-3-4-14-15(9-13)24-12-23-14/h3-4,9,16H,2,5-8,10-12H2,1H3/t16-,18+/m1/s1 |
| InChIKey | VHGLRMWPVAHQRJ-AEFFLSMTSA-N |
| XLogP | 2.07 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |