C20H24N2O3 — CID 97363098
[(4aS,8aS)-4a-(methoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-quinolin-3-ylmethanone (PubChem CID 97363098) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is [(4aS,8aS)-4a-(methoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-quinolin-3-ylmethanone.
| Compound Name | [(4aS,8aS)-4a-(methoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-quinolin-3-ylmethanone |
|---|---|
| PubChem CID | 97363098 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | [(4aS,8aS)-4a-(methoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-quinolin-3-ylmethanone |
| SMILES | COC[C@@]12CCCO[C@H]1CCN(C(=O)c1cnc3ccccc3c1)C2 |
| InChI | InChI=1S/C20H24N2O3/c1-24-14-20-8-4-10-25-18(20)7-9-22(13-20)19(23)16-11-15-5-2-3-6-17(15)21-12-16/h2-3,5-6,11-12,18H,4,7-10,13-14H2,1H3/t18-,20-/m0/s1 |
| InChIKey | AQSASGYPDWDKNR-ICSRJNTNSA-N |
| XLogP | 2.89 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |