C18H20N4O3 — CID 97460623
[(3aS,5S,7aS)-5-(pyridin-3-yloxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-pyridazin-4-ylmethanone (PubChem CID 97460623) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is [(3aS,5S,7aS)-5-(pyridin-3-yloxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-pyridazin-4-ylmethanone.
| Compound Name | [(3aS,5S,7aS)-5-(pyridin-3-yloxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-pyridazin-4-ylmethanone |
|---|---|
| PubChem CID | 97460623 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | [(3aS,5S,7aS)-5-(pyridin-3-yloxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-pyridazin-4-ylmethanone |
| SMILES | O=C(c1ccnnc1)N1CC[C@@H]2O[C@H](COc3cccnc3)CC[C@@H]21 |
| InChI | InChI=1S/C18H20N4O3/c23-18(13-5-8-20-21-10-13)22-9-6-17-16(22)4-3-15(25-17)12-24-14-2-1-7-19-11-14/h1-2,5,7-8,10-11,15-17H,3-4,6,9,12H2/t15-,16-,17-/m0/s1 |
| InChIKey | ONBVAZYUYMLRHZ-ULQDDVLXSA-N |
| XLogP | 1.71 |
| TPSA | 77.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |