C17H19N5O3 — CID 97403531
[(4aS,7R,7aR)-7-(pyrimidin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-pyridazin-4-ylmethanone (PubChem CID 97403531) has the molecular formula C17H19N5O3 and a molecular weight of 341.37 g/mol. Its IUPAC name is [(4aS,7R,7aR)-7-(pyrimidin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-pyridazin-4-ylmethanone.
| Compound Name | [(4aS,7R,7aR)-7-(pyrimidin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-pyridazin-4-ylmethanone |
|---|---|
| PubChem CID | 97403531 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | [(4aS,7R,7aR)-7-(pyrimidin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-pyridazin-4-ylmethanone |
| SMILES | O=C(c1ccnnc1)N1CCO[C@@H]2[C@@H](COc3ncccn3)CC[C@@H]21 |
| InChI | InChI=1S/C17H19N5O3/c23-16(12-4-7-20-21-10-12)22-8-9-24-15-13(2-3-14(15)22)11-25-17-18-5-1-6-19-17/h1,4-7,10,13-15H,2-3,8-9,11H2/t13-,14+,15-/m1/s1 |
| InChIKey | ZILLKUFAKHEQGJ-QLFBSQMISA-N |
| XLogP | 0.97 |
| TPSA | 90.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |