C14H20N4O2S — CID 124810251
2-[(3aR,6aR)-5-oxo-1-(1,3-thiazol-2-ylmethyl)-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-4-yl]-N,N-dimethylacetamide (PubChem CID 124810251) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is 2-[(3aR,6aR)-5-oxo-1-(1,3-thiazol-2-ylmethyl)-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-4-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[(3aR,6aR)-5-oxo-1-(1,3-thiazol-2-ylmethyl)-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-4-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 124810251 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-[(3aR,6aR)-5-oxo-1-(1,3-thiazol-2-ylmethyl)-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-4-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1C(=O)C[C@@H]2[C@H]1CCN2Cc1nccs1 |
| InChI | InChI=1S/C14H20N4O2S/c1-16(2)14(20)9-18-10-3-5-17(11(10)7-13(18)19)8-12-15-4-6-21-12/h4,6,10-11H,3,5,7-9H2,1-2H3/t10-,11-/m1/s1 |
| InChIKey | VAFZAZFDKMKTMK-GHMZBOCLSA-N |
| XLogP | 0.41 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |