C16H23N3O2S — CID 98778739
2-[(3aR,6aR)-1-[(5-methylthiophen-2-yl)methyl]-5-oxo-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-4-yl]-N,N-dimethylacetamide (PubChem CID 98778739) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is 2-[(3aR,6aR)-1-[(5-methylthiophen-2-yl)methyl]-5-oxo-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-4-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[(3aR,6aR)-1-[(5-methylthiophen-2-yl)methyl]-5-oxo-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-4-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 98778739 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 2-[(3aR,6aR)-1-[(5-methylthiophen-2-yl)methyl]-5-oxo-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-4-yl]-N,N-dimethylacetamide |
| SMILES | Cc1ccc(CN2CC[C@@H]3[C@H]2CC(=O)N3CC(=O)N(C)C)s1 |
| InChI | InChI=1S/C16H23N3O2S/c1-11-4-5-12(22-11)9-18-7-6-13-14(18)8-15(20)19(13)10-16(21)17(2)3/h4-5,13-14H,6-10H2,1-3H3/t13-,14-/m1/s1 |
| InChIKey | XIQGPTANKSBQCQ-ZIAGYGMSSA-N |
| XLogP | 1.32 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |