C19H22N2O2S2 — CID 70739645
1-[5-[(3aS,6aS)-1-[(5-methylthiophen-2-yl)methyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carbonyl]thiophen-2-yl]ethanone (PubChem CID 70739645) has the molecular formula C19H22N2O2S2 and a molecular weight of 374.53 g/mol. Its IUPAC name is 1-[5-[(3aS,6aS)-1-[(5-methylthiophen-2-yl)methyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carbonyl]thiophen-2-yl]ethanone.
| Compound Name | 1-[5-[(3aS,6aS)-1-[(5-methylthiophen-2-yl)methyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carbonyl]thiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 70739645 |
| Molecular Formula | C19H22N2O2S2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 1-[5-[(3aS,6aS)-1-[(5-methylthiophen-2-yl)methyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carbonyl]thiophen-2-yl]ethanone |
| SMILES | CC(=O)c1ccc(C(=O)N2C[C@@H]3CCN(Cc4ccc(C)s4)[C@@H]3C2)s1 |
| InChI | InChI=1S/C19H22N2O2S2/c1-12-3-4-15(24-12)10-20-8-7-14-9-21(11-16(14)20)19(23)18-6-5-17(25-18)13(2)22/h3-6,14,16H,7-11H2,1-2H3/t14-,16+/m0/s1 |
| InChIKey | TZOUSFDWSDHFAJ-GOEBONIOSA-N |
| XLogP | 3.67 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |