C18H26N2O2S — CID 124813328
(3aS,5S,7aS)-N-(cyclopropylmethyl)-1-[(5-methylthiophen-2-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide (PubChem CID 124813328) has the molecular formula C18H26N2O2S and a molecular weight of 334.49 g/mol. Its IUPAC name is (3aS,5S,7aS)-N-(cyclopropylmethyl)-1-[(5-methylthiophen-2-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide.
| Compound Name | (3aS,5S,7aS)-N-(cyclopropylmethyl)-1-[(5-methylthiophen-2-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 124813328 |
| Molecular Formula | C18H26N2O2S |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (3aS,5S,7aS)-N-(cyclopropylmethyl)-1-[(5-methylthiophen-2-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide |
| SMILES | Cc1ccc(CN2CC[C@@H]3O[C@H](C(=O)NCC4CC4)CC[C@@H]32)s1 |
| InChI | InChI=1S/C18H26N2O2S/c1-12-2-5-14(23-12)11-20-9-8-16-15(20)6-7-17(22-16)18(21)19-10-13-3-4-13/h2,5,13,15-17H,3-4,6-11H2,1H3,(H,19,21)/t15-,16-,17-/m0/s1 |
| InChIKey | HTVWKYYGTNAPSX-ULQDDVLXSA-N |
| XLogP | 2.70 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |