C17H23F3N2O4S — CID 155829670
(3aR,5R,7aR)-N-methyl-1-[(5-methylthiophen-2-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155829670) has the molecular formula C17H23F3N2O4S and a molecular weight of 408.44 g/mol. Its IUPAC name is (3aR,5R,7aR)-N-methyl-1-[(5-methylthiophen-2-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,5R,7aR)-N-methyl-1-[(5-methylthiophen-2-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155829670 |
| Molecular Formula | C17H23F3N2O4S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | (3aR,5R,7aR)-N-methyl-1-[(5-methylthiophen-2-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CNC(=O)[C@H]1CC[C@@H]2[C@@H](CCN2Cc2ccc(C)s2)O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H22N2O2S.C2HF3O2/c1-10-3-4-11(20-10)9-17-8-7-13-12(17)5-6-14(19-13)15(18)16-2;3-2(4,5)1(6)7/h3-4,12-14H,5-9H2,1-2H3,(H,16,18);(H,6,7)/t12-,13-,14-;/m1./s1 |
| InChIKey | BOKUIRVIXUXJDV-MBLYYGPHSA-N |
| XLogP | 2.56 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |