C18H20F6N4O4S2 — CID 155860461
2-[(3aS,6aR)-1-[(5-methylthiophen-2-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-1,3,4-thiadiazole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155860461) has the molecular formula C18H20F6N4O4S2 and a molecular weight of 534.50 g/mol. Its IUPAC name is 2-[(3aS,6aR)-1-[(5-methylthiophen-2-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-1,3,4-thiadiazole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[(3aS,6aR)-1-[(5-methylthiophen-2-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-1,3,4-thiadiazole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155860461 |
| Molecular Formula | C18H20F6N4O4S2 |
| Molecular Weight | 534.50 g/mol |
| Exact Mass | 534.08 |
| IUPAC Name | 2-[(3aS,6aR)-1-[(5-methylthiophen-2-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-1,3,4-thiadiazole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1ccc(CN2CC[C@H]3[C@H]2CCN3c2nncs2)s1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H18N4S2.2C2HF3O2/c1-10-2-3-11(20-10)8-17-6-4-13-12(17)5-7-18(13)14-16-15-9-19-14;2*3-2(4,5)1(6)7/h2-3,9,12-13H,4-8H2,1H3;2*(H,6,7)/t12-,13+;;/m1../s1 |
| InChIKey | GRGBPZHQVAYZQH-VAALMUBNSA-N |
| XLogP | 4.03 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |