C15H20N4OS — CID 97459423
2-[(3aS,6aR)-1-[(5-ethylfuran-2-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-1,3,4-thiadiazole (PubChem CID 97459423) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is 2-[(3aS,6aR)-1-[(5-ethylfuran-2-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-1,3,4-thiadiazole.
| Compound Name | 2-[(3aS,6aR)-1-[(5-ethylfuran-2-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 97459423 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 2-[(3aS,6aR)-1-[(5-ethylfuran-2-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-1,3,4-thiadiazole |
| SMILES | CCc1ccc(CN2CC[C@H]3[C@H]2CCN3c2nncs2)o1 |
| InChI | InChI=1S/C15H20N4OS/c1-2-11-3-4-12(20-11)9-18-7-5-14-13(18)6-8-19(14)15-17-16-10-21-15/h3-4,10,13-14H,2,5-9H2,1H3/t13-,14+/m1/s1 |
| InChIKey | UMAKWFHZYFYBOE-KGLIPLIRSA-N |
| XLogP | 2.55 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |