C13H18N2OS — CID 99777594
[(3aS,4R,6aR)-4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(5-methylthiophen-2-yl)methanone (PubChem CID 99777594) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is [(3aS,4R,6aR)-4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(5-methylthiophen-2-yl)methanone.
| Compound Name | [(3aS,4R,6aR)-4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(5-methylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 99777594 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | [(3aS,4R,6aR)-4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(5-methylthiophen-2-yl)methanone |
| SMILES | Cc1ccc(C(=O)N2C[C@@H]3CC[C@@H](N)[C@@H]3C2)s1 |
| InChI | InChI=1S/C13H18N2OS/c1-8-2-5-12(17-8)13(16)15-6-9-3-4-11(14)10(9)7-15/h2,5,9-11H,3-4,6-7,14H2,1H3/t9-,10+,11+/m0/s1 |
| InChIKey | VKWPZQKIWRYBCF-HBNTYKKESA-N |
| XLogP | 1.87 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |