C20H23NO4S2 — CID 174161311
[(6aR)-2-(5-methylthiophene-2-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl] 4-methylbenzenesulfonate (PubChem CID 174161311) has the molecular formula C20H23NO4S2 and a molecular weight of 405.54 g/mol. Its IUPAC name is [(6aR)-2-(5-methylthiophene-2-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl] 4-methylbenzenesulfonate.
| Compound Name | [(6aR)-2-(5-methylthiophene-2-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 174161311 |
| Molecular Formula | C20H23NO4S2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | [(6aR)-2-(5-methylthiophene-2-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CC[C@H]3CN(C(=O)c4ccc(C)s4)CC23)cc1 |
| InChI | InChI=1S/C20H23NO4S2/c1-13-3-7-16(8-4-13)27(23,24)25-18-9-6-15-11-21(12-17(15)18)20(22)19-10-5-14(2)26-19/h3-5,7-8,10,15,17-18H,6,9,11-12H2,1-2H3/t15-,17?,18?/m0/s1 |
| InChIKey | AYDDRNBDNQURIE-ZLPCBKJTSA-N |
| XLogP | 3.62 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|