C17H21N3O3S — CID 97367173
[(4R,4aS,8aR)-4-(3-methyl-1,2,4-oxadiazol-5-yl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-(5-methylthiophen-2-yl)methanone (PubChem CID 97367173) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is [(4R,4aS,8aR)-4-(3-methyl-1,2,4-oxadiazol-5-yl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-(5-methylthiophen-2-yl)methanone.
| Compound Name | [(4R,4aS,8aR)-4-(3-methyl-1,2,4-oxadiazol-5-yl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-(5-methylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 97367173 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | [(4R,4aS,8aR)-4-(3-methyl-1,2,4-oxadiazol-5-yl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-(5-methylthiophen-2-yl)methanone |
| SMILES | Cc1noc([C@@H]2CCO[C@@H]3CCN(C(=O)c4ccc(C)s4)C[C@@H]32)n1 |
| InChI | InChI=1S/C17H21N3O3S/c1-10-3-4-15(24-10)17(21)20-7-5-14-13(9-20)12(6-8-22-14)16-18-11(2)19-23-16/h3-4,12-14H,5-9H2,1-2H3/t12-,13-,14-/m1/s1 |
| InChIKey | FSIDJXNKUHIUPF-MGPQQGTHSA-N |
| XLogP | 2.78 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |