C12H17N3OS — CID 124617708
[(3aS,4S,6aR)-4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(4-methyl-1,3-thiazol-5-yl)methanone (PubChem CID 124617708) has the molecular formula C12H17N3OS and a molecular weight of 251.35 g/mol. Its IUPAC name is [(3aS,4S,6aR)-4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(4-methyl-1,3-thiazol-5-yl)methanone.
| Compound Name | [(3aS,4S,6aR)-4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(4-methyl-1,3-thiazol-5-yl)methanone |
|---|---|
| PubChem CID | 124617708 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | [(3aS,4S,6aR)-4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(4-methyl-1,3-thiazol-5-yl)methanone |
| SMILES | Cc1ncsc1C(=O)N1C[C@@H]2CC[C@H](N)[C@@H]2C1 |
| InChI | InChI=1S/C12H17N3OS/c1-7-11(17-6-14-7)12(16)15-4-8-2-3-10(13)9(8)5-15/h6,8-10H,2-5,13H2,1H3/t8-,9+,10-/m0/s1 |
| InChIKey | AXEQUSCPSYJJOK-AEJSXWLSSA-N |
| XLogP | 1.26 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |