C8H9N5OS — CID 121200546
(3-azidoazetidin-1-yl)-(4-methyl-1,3-thiazol-5-yl)methanone (PubChem CID 121200546) has the molecular formula C8H9N5OS and a molecular weight of 223.26 g/mol. Its IUPAC name is (3-azidoazetidin-1-yl)-(4-methyl-1,3-thiazol-5-yl)methanone.
| Compound Name | (3-azidoazetidin-1-yl)-(4-methyl-1,3-thiazol-5-yl)methanone |
|---|---|
| PubChem CID | 121200546 |
| Molecular Formula | C8H9N5OS |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | (3-azidoazetidin-1-yl)-(4-methyl-1,3-thiazol-5-yl)methanone |
| SMILES | Cc1ncsc1C(=O)N1CC(N=[N+]=[N-])C1 |
| InChI | InChI=1S/C8H9N5OS/c1-5-7(15-4-10-5)8(14)13-2-6(3-13)11-12-9/h4,6H,2-3H2,1H3 |
| InChIKey | DIZMBAHZBSKQEY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 81.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|