C19H23N3OS — CID 97422956
(3aR,7aR)-1-[(5-methylthiophen-2-yl)methyl]-4-(pyridin-4-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one (PubChem CID 97422956) has the molecular formula C19H23N3OS and a molecular weight of 341.48 g/mol. Its IUPAC name is (3aR,7aR)-1-[(5-methylthiophen-2-yl)methyl]-4-(pyridin-4-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one.
| Compound Name | (3aR,7aR)-1-[(5-methylthiophen-2-yl)methyl]-4-(pyridin-4-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 97422956 |
| Molecular Formula | C19H23N3OS |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | (3aR,7aR)-1-[(5-methylthiophen-2-yl)methyl]-4-(pyridin-4-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one |
| SMILES | Cc1ccc(CN2CC[C@@H]3[C@H]2CCC(=O)N3Cc2ccncc2)s1 |
| InChI | InChI=1S/C19H23N3OS/c1-14-2-3-16(24-14)13-21-11-8-18-17(21)4-5-19(23)22(18)12-15-6-9-20-10-7-15/h2-3,6-7,9-10,17-18H,4-5,8,11-13H2,1H3/t17-,18-/m1/s1 |
| InChIKey | DQFLKUUURVTMFN-QZTJIDSGSA-N |
| XLogP | 3.22 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |