C17H23N3O2 — CID 133141124
(3aR,7aR)-1-(oxolan-3-yl)-4-(pyridin-4-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one (PubChem CID 133141124) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is (3aR,7aR)-1-(oxolan-3-yl)-4-(pyridin-4-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one.
| Compound Name | (3aR,7aR)-1-(oxolan-3-yl)-4-(pyridin-4-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 133141124 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | (3aR,7aR)-1-(oxolan-3-yl)-4-(pyridin-4-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one |
| SMILES | O=C1CC[C@@H]2[C@@H](CCN2C2CCOC2)N1Cc1ccncc1 |
| InChI | InChI=1S/C17H23N3O2/c21-17-2-1-15-16(5-9-19(15)14-6-10-22-12-14)20(17)11-13-3-7-18-8-4-13/h3-4,7-8,14-16H,1-2,5-6,9-12H2/t14?,15-,16-/m1/s1 |
| InChIKey | CASHZOMKZVQZLY-ANGDWKNPSA-N |
| XLogP | 1.44 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |