C21H29F6N3O6 — CID 155869342
[(1R,3aR,7aR)-1-(diethylaminomethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-(1H-pyrrol-3-yl)methanone;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155869342) has the molecular formula C21H29F6N3O6 and a molecular weight of 533.47 g/mol. Its IUPAC name is [(1R,3aR,7aR)-1-(diethylaminomethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-(1H-pyrrol-3-yl)methanone;bis(2,2,2-trifluoroacetic acid).
| Compound Name | [(1R,3aR,7aR)-1-(diethylaminomethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-(1H-pyrrol-3-yl)methanone;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155869342 |
| Molecular Formula | C21H29F6N3O6 |
| Molecular Weight | 533.47 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | [(1R,3aR,7aR)-1-(diethylaminomethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-(1H-pyrrol-3-yl)methanone;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCN(CC)C[C@@H]1OC[C@H]2CN(C(=O)c3cc[nH]c3)CC[C@H]21.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H27N3O2.2C2HF3O2/c1-3-19(4-2)11-16-15-6-8-20(10-14(15)12-22-16)17(21)13-5-7-18-9-13;2*3-2(4,5)1(6)7/h5,7,9,14-16,18H,3-4,6,8,10-12H2,1-2H3;2*(H,6,7)/t14-,15-,16+;;/m1../s1 |
| InChIKey | QZXRCTILCHGJSA-DJJRUWCQSA-N |
| XLogP | 3.10 |
| TPSA | 123.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |