C19H27F3N2O5S — CID 155853585
1-[(1R,3aS,7aS)-5-(3-methylphenyl)sulfonyl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N,N-dimethylmethanamine;2,2,2-trifluoroacetic acid (PubChem CID 155853585) has the molecular formula C19H27F3N2O5S and a molecular weight of 452.50 g/mol. Its IUPAC name is 1-[(1R,3aS,7aS)-5-(3-methylphenyl)sulfonyl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N,N-dimethylmethanamine;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(1R,3aS,7aS)-5-(3-methylphenyl)sulfonyl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N,N-dimethylmethanamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155853585 |
| Molecular Formula | C19H27F3N2O5S |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 1-[(1R,3aS,7aS)-5-(3-methylphenyl)sulfonyl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N,N-dimethylmethanamine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cccc(S(=O)(=O)N2CC[C@H]3[C@H](CO[C@H]3CN(C)C)C2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H26N2O3S.C2HF3O2/c1-13-5-4-6-15(9-13)23(20,21)19-8-7-16-14(10-19)12-22-17(16)11-18(2)3;3-2(4,5)1(6)7/h4-6,9,14,16-17H,7-8,10-12H2,1-3H3;(H,6,7)/t14-,16-,17-;/m0./s1 |
| InChIKey | WQQVYUYICXRPGL-BDURURIASA-N |
| XLogP | 2.22 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |