C16H23FN2O3S — CID 97459772
1-[(1R,3aR,7aR)-5-(4-fluorophenyl)sulfonyl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N,N-dimethylmethanamine (PubChem CID 97459772) has the molecular formula C16H23FN2O3S and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-[(1R,3aR,7aR)-5-(4-fluorophenyl)sulfonyl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[(1R,3aR,7aR)-5-(4-fluorophenyl)sulfonyl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 97459772 |
| Molecular Formula | C16H23FN2O3S |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 1-[(1R,3aR,7aR)-5-(4-fluorophenyl)sulfonyl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N,N-dimethylmethanamine |
| SMILES | CN(C)C[C@@H]1OC[C@H]2CN(S(=O)(=O)c3ccc(F)cc3)CC[C@H]21 |
| InChI | InChI=1S/C16H23FN2O3S/c1-18(2)10-16-15-7-8-19(9-12(15)11-22-16)23(20,21)14-5-3-13(17)4-6-14/h3-6,12,15-16H,7-11H2,1-2H3/t12-,15-,16+/m1/s1 |
| InChIKey | ZLXNMPMFPBELEN-WQVCFCJDSA-N |
| XLogP | 1.41 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |