C18H24N2O4 — CID 97387999
[(1R,3aS,7aS)-1-[(dimethylamino)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-(1,3-benzodioxol-5-yl)methanone (PubChem CID 97387999) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is [(1R,3aS,7aS)-1-[(dimethylamino)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-(1,3-benzodioxol-5-yl)methanone.
| Compound Name | [(1R,3aS,7aS)-1-[(dimethylamino)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-(1,3-benzodioxol-5-yl)methanone |
|---|---|
| PubChem CID | 97387999 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | [(1R,3aS,7aS)-1-[(dimethylamino)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-(1,3-benzodioxol-5-yl)methanone |
| SMILES | CN(C)C[C@@H]1OC[C@@H]2CN(C(=O)c3ccc4c(c3)OCO4)CC[C@@H]21 |
| InChI | InChI=1S/C18H24N2O4/c1-19(2)9-17-14-5-6-20(8-13(14)10-22-17)18(21)12-3-4-15-16(7-12)24-11-23-15/h3-4,7,13-14,17H,5-6,8-11H2,1-2H3/t13-,14-,17-/m0/s1 |
| InChIKey | PFSDVPGPECRSDZ-ZQIUZPCESA-N |
| XLogP | 1.45 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |