C22H29F3N2O6 — CID 155838753
[(3aR,5R,7aR)-1-[(4-methoxyphenyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-morpholin-4-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 155838753) has the molecular formula C22H29F3N2O6 and a molecular weight of 474.48 g/mol. Its IUPAC name is [(3aR,5R,7aR)-1-[(4-methoxyphenyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-morpholin-4-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3aR,5R,7aR)-1-[(4-methoxyphenyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-morpholin-4-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155838753 |
| Molecular Formula | C22H29F3N2O6 |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | [(3aR,5R,7aR)-1-[(4-methoxyphenyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-morpholin-4-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(CN2CC[C@H]3O[C@@H](C(=O)N4CCOCC4)CC[C@H]32)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H28N2O4.C2HF3O2/c1-24-16-4-2-15(3-5-16)14-22-9-8-18-17(22)6-7-19(26-18)20(23)21-10-12-25-13-11-21;3-2(4,5)1(6)7/h2-5,17-19H,6-14H2,1H3;(H,6,7)/t17-,18-,19-;/m1./s1 |
| InChIKey | JXPAKFCXDQCLAI-OYXQGUJPSA-N |
| XLogP | 2.31 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |