C19H26N2O4 — CID 124796458
[(3aS,5S,7aS)-1-[(4-methoxyphenyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-(1,2-oxazolidin-2-yl)methanone (PubChem CID 124796458) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is [(3aS,5S,7aS)-1-[(4-methoxyphenyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-(1,2-oxazolidin-2-yl)methanone.
| Compound Name | [(3aS,5S,7aS)-1-[(4-methoxyphenyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-(1,2-oxazolidin-2-yl)methanone |
|---|---|
| PubChem CID | 124796458 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | [(3aS,5S,7aS)-1-[(4-methoxyphenyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-(1,2-oxazolidin-2-yl)methanone |
| SMILES | COc1ccc(CN2CC[C@@H]3O[C@H](C(=O)N4CCCO4)CC[C@@H]32)cc1 |
| InChI | InChI=1S/C19H26N2O4/c1-23-15-5-3-14(4-6-15)13-20-11-9-17-16(20)7-8-18(25-17)19(22)21-10-2-12-24-21/h3-6,16-18H,2,7-13H2,1H3/t16-,17-,18-/m0/s1 |
| InChIKey | MIYAXFIPDDEKJX-BZSNNMDCSA-N |
| XLogP | 1.98 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |