C14H21N3O — CID 173262654
(5aR,9aR)-1-(pyridin-3-ylmethyl)-3,5,5a,6,7,8,9,9a-octahydro-2H-pyrido[3,4-e][1,4]oxazepine (PubChem CID 173262654) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is (5aR,9aR)-1-(pyridin-3-ylmethyl)-3,5,5a,6,7,8,9,9a-octahydro-2H-pyrido[3,4-e][1,4]oxazepine.
| Compound Name | (5aR,9aR)-1-(pyridin-3-ylmethyl)-3,5,5a,6,7,8,9,9a-octahydro-2H-pyrido[3,4-e][1,4]oxazepine |
|---|---|
| PubChem CID | 173262654 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | (5aR,9aR)-1-(pyridin-3-ylmethyl)-3,5,5a,6,7,8,9,9a-octahydro-2H-pyrido[3,4-e][1,4]oxazepine |
| SMILES | c1cncc(CN2CCOC[C@@H]3CCNC[C@@H]32)c1 |
| InChI | InChI=1S/C14H21N3O/c1-2-12(8-15-4-1)10-17-6-7-18-11-13-3-5-16-9-14(13)17/h1-2,4,8,13-14,16H,3,5-7,9-11H2/t13-,14-/m0/s1 |
| InChIKey | BXQPBDDPSUEGMU-KBPBESRZSA-N |
| XLogP | 0.89 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |