C16H23N3 — CID 64861091
2,5-dicyclopropyl-1-(pyridin-3-ylmethyl)piperazine (PubChem CID 64861091) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is 2,5-dicyclopropyl-1-(pyridin-3-ylmethyl)piperazine.
| Compound Name | 2,5-dicyclopropyl-1-(pyridin-3-ylmethyl)piperazine |
|---|---|
| PubChem CID | 64861091 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | 2,5-dicyclopropyl-1-(pyridin-3-ylmethyl)piperazine |
| SMILES | c1cncc(CN2CC(C3CC3)NCC2C2CC2)c1 |
| InChI | InChI=1S/C16H23N3/c1-2-12(8-17-7-1)10-19-11-15(13-3-4-13)18-9-16(19)14-5-6-14/h1-2,7-8,13-16,18H,3-6,9-11H2 |
| InChIKey | MRYWXZMEOPUAMP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |