C17H23ClN2 — CID 64862434
1-[(3-chlorophenyl)methyl]-2,5-dicyclopropylpiperazine (PubChem CID 64862434) has the molecular formula C17H23ClN2 and a molecular weight of 290.84 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-2,5-dicyclopropylpiperazine.
| Compound Name | 1-[(3-chlorophenyl)methyl]-2,5-dicyclopropylpiperazine |
|---|---|
| PubChem CID | 64862434 |
| Molecular Formula | C17H23ClN2 |
| Molecular Weight | 290.84 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-2,5-dicyclopropylpiperazine |
| SMILES | Clc1cccc(CN2CC(C3CC3)NCC2C2CC2)c1 |
| InChI | InChI=1S/C17H23ClN2/c18-15-3-1-2-12(8-15)10-20-11-16(13-4-5-13)19-9-17(20)14-6-7-14/h1-3,8,13-14,16-17,19H,4-7,9-11H2 |
| InChIKey | LWHNKQVVELHKHE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.84 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |