C17H22Cl2N2 — CID 107310522
2,5-dicyclopropyl-1-[(2,3-dichlorophenyl)methyl]piperazine (PubChem CID 107310522) has the molecular formula C17H22Cl2N2 and a molecular weight of 325.28 g/mol. Its IUPAC name is 2,5-dicyclopropyl-1-[(2,3-dichlorophenyl)methyl]piperazine.
| Compound Name | 2,5-dicyclopropyl-1-[(2,3-dichlorophenyl)methyl]piperazine |
|---|---|
| PubChem CID | 107310522 |
| Molecular Formula | C17H22Cl2N2 |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 2,5-dicyclopropyl-1-[(2,3-dichlorophenyl)methyl]piperazine |
| SMILES | Clc1cccc(CN2CC(C3CC3)NCC2C2CC2)c1Cl |
| InChI | InChI=1S/C17H22Cl2N2/c18-14-3-1-2-13(17(14)19)9-21-10-15(11-4-5-11)20-8-16(21)12-6-7-12/h1-3,11-12,15-16,20H,4-10H2 |
| InChIKey | OGIATKYIHURFIA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |