C17H24Cl2N2 — CID 65317988
2-cyclopropyl-1-[(2,5-dichlorophenyl)methyl]-5-propylpiperazine (PubChem CID 65317988) has the molecular formula C17H24Cl2N2 and a molecular weight of 327.30 g/mol. Its IUPAC name is 2-cyclopropyl-1-[(2,5-dichlorophenyl)methyl]-5-propylpiperazine.
| Compound Name | 2-cyclopropyl-1-[(2,5-dichlorophenyl)methyl]-5-propylpiperazine |
|---|---|
| PubChem CID | 65317988 |
| Molecular Formula | C17H24Cl2N2 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-cyclopropyl-1-[(2,5-dichlorophenyl)methyl]-5-propylpiperazine |
| SMILES | CCCC1CN(Cc2cc(Cl)ccc2Cl)C(C2CC2)CN1 |
| InChI | InChI=1S/C17H24Cl2N2/c1-2-3-15-11-21(17(9-20-15)12-4-5-12)10-13-8-14(18)6-7-16(13)19/h6-8,12,15,17,20H,2-5,9-11H2,1H3 |
| InChIKey | ZGMIGALZVWZBNR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |