C16H22F2N2 — CID 82924639
2-cyclopropyl-1-[(3,4-difluorophenyl)methyl]-5-ethylpiperazine (PubChem CID 82924639) has the molecular formula C16H22F2N2 and a molecular weight of 280.36 g/mol. Its IUPAC name is 2-cyclopropyl-1-[(3,4-difluorophenyl)methyl]-5-ethylpiperazine.
| Compound Name | 2-cyclopropyl-1-[(3,4-difluorophenyl)methyl]-5-ethylpiperazine |
|---|---|
| PubChem CID | 82924639 |
| Molecular Formula | C16H22F2N2 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 2-cyclopropyl-1-[(3,4-difluorophenyl)methyl]-5-ethylpiperazine |
| SMILES | CCC1CN(Cc2ccc(F)c(F)c2)C(C2CC2)CN1 |
| InChI | InChI=1S/C16H22F2N2/c1-2-13-10-20(16(8-19-13)12-4-5-12)9-11-3-6-14(17)15(18)7-11/h3,6-7,12-13,16,19H,2,4-5,8-10H2,1H3 |
| InChIKey | GUFPAQJCCSXVOK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |