C16H24N2S — CID 64859740
2,5-dicyclopropyl-1-(2-thiophen-2-ylethyl)piperazine (PubChem CID 64859740) has the molecular formula C16H24N2S and a molecular weight of 276.45 g/mol. Its IUPAC name is 2,5-dicyclopropyl-1-(2-thiophen-2-ylethyl)piperazine.
| Compound Name | 2,5-dicyclopropyl-1-(2-thiophen-2-ylethyl)piperazine |
|---|---|
| PubChem CID | 64859740 |
| Molecular Formula | C16H24N2S |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 2,5-dicyclopropyl-1-(2-thiophen-2-ylethyl)piperazine |
| SMILES | c1csc(CCN2CC(C3CC3)NCC2C2CC2)c1 |
| InChI | InChI=1S/C16H24N2S/c1-2-14(19-9-1)7-8-18-11-15(12-3-4-12)17-10-16(18)13-5-6-13/h1-2,9,12-13,15-17H,3-8,10-11H2 |
| InChIKey | SWBDNHTWSSRAKT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |