C18H27ClN2 — CID 64861094
2-tert-butyl-1-[(3-chlorophenyl)methyl]-5-cyclopropylpiperazine (PubChem CID 64861094) has the molecular formula C18H27ClN2 and a molecular weight of 306.88 g/mol. Its IUPAC name is 2-tert-butyl-1-[(3-chlorophenyl)methyl]-5-cyclopropylpiperazine.
| Compound Name | 2-tert-butyl-1-[(3-chlorophenyl)methyl]-5-cyclopropylpiperazine |
|---|---|
| PubChem CID | 64861094 |
| Molecular Formula | C18H27ClN2 |
| Molecular Weight | 306.88 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 2-tert-butyl-1-[(3-chlorophenyl)methyl]-5-cyclopropylpiperazine |
| SMILES | CC(C)(C)C1CNC(C2CC2)CN1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H27ClN2/c1-18(2,3)17-10-20-16(14-7-8-14)12-21(17)11-13-5-4-6-15(19)9-13/h4-6,9,14,16-17,20H,7-8,10-12H2,1-3H3 |
| InChIKey | XXFRGLLKAOXMNS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.88 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |