C17H24N2O3 — CID 127023842
1-[(3aR,7aS)-4-(pyridin-3-ylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-methoxyethanone (PubChem CID 127023842) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 1-[(3aR,7aS)-4-(pyridin-3-ylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-methoxyethanone.
| Compound Name | 1-[(3aR,7aS)-4-(pyridin-3-ylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 127023842 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 1-[(3aR,7aS)-4-(pyridin-3-ylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1C[C@H]2CCCC(OCc3cccnc3)[C@H]2C1 |
| InChI | InChI=1S/C17H24N2O3/c1-21-12-17(20)19-9-14-5-2-6-16(15(14)10-19)22-11-13-4-3-7-18-8-13/h3-4,7-8,14-16H,2,5-6,9-12H2,1H3/t14-,15+,16?/m1/s1 |
| InChIKey | GRZAHBFVXMNXHS-YSPPHNQVSA-N |
| XLogP | 1.87 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |