C21H24N2O3 — CID 110142297
1-[(3aR,4S,6aS)-4-pyridin-3-yloxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2-(3-methoxyphenyl)ethanone (PubChem CID 110142297) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 1-[(3aR,4S,6aS)-4-pyridin-3-yloxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2-(3-methoxyphenyl)ethanone.
| Compound Name | 1-[(3aR,4S,6aS)-4-pyridin-3-yloxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2-(3-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 110142297 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 1-[(3aR,4S,6aS)-4-pyridin-3-yloxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2-(3-methoxyphenyl)ethanone |
| SMILES | COc1cccc(CC(=O)N2C[C@H]3CC[C@H](Oc4cccnc4)[C@H]3C2)c1 |
| InChI | InChI=1S/C21H24N2O3/c1-25-17-5-2-4-15(10-17)11-21(24)23-13-16-7-8-20(19(16)14-23)26-18-6-3-9-22-12-18/h2-6,9-10,12,16,19-20H,7-8,11,13-14H2,1H3/t16-,19+,20+/m1/s1 |
| InChIKey | YXYHVMJCKVTXQJ-UXPWSPDFSA-N |
| XLogP | 2.95 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |