C19H27N3O2 — CID 110131341
[(3aR,4R,6aS)-4-pyridin-3-yloxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(1-methylpiperidin-4-yl)methanone (PubChem CID 110131341) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is [(3aR,4R,6aS)-4-pyridin-3-yloxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(1-methylpiperidin-4-yl)methanone.
| Compound Name | [(3aR,4R,6aS)-4-pyridin-3-yloxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(1-methylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 110131341 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | [(3aR,4R,6aS)-4-pyridin-3-yloxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(1-methylpiperidin-4-yl)methanone |
| SMILES | CN1CCC(C(=O)N2C[C@H]3CC[C@@H](Oc4cccnc4)[C@H]3C2)CC1 |
| InChI | InChI=1S/C19H27N3O2/c1-21-9-6-14(7-10-21)19(23)22-12-15-4-5-18(17(15)13-22)24-16-3-2-8-20-11-16/h2-3,8,11,14-15,17-18H,4-7,9-10,12-13H2,1H3/t15-,17+,18-/m1/s1 |
| InChIKey | ITADLEJCHGLQBC-BPQIPLTHSA-N |
| XLogP | 2.04 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |