C20H22N2O3 — CID 110131214
1-[(3aR,4R,6aS)-4-pyridin-3-yloxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2-phenoxyethanone (PubChem CID 110131214) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 1-[(3aR,4R,6aS)-4-pyridin-3-yloxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2-phenoxyethanone.
| Compound Name | 1-[(3aR,4R,6aS)-4-pyridin-3-yloxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 110131214 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 1-[(3aR,4R,6aS)-4-pyridin-3-yloxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2-phenoxyethanone |
| SMILES | O=C(COc1ccccc1)N1C[C@H]2CC[C@@H](Oc3cccnc3)[C@H]2C1 |
| InChI | InChI=1S/C20H22N2O3/c23-20(14-24-16-5-2-1-3-6-16)22-12-15-8-9-19(18(15)13-22)25-17-7-4-10-21-11-17/h1-7,10-11,15,18-19H,8-9,12-14H2/t15-,18+,19-/m1/s1 |
| InChIKey | MCXMNUGVHOPIJL-AYOQOUSVSA-N |
| XLogP | 2.78 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |