C23H22N2O2 — CID 110121460
[(3aS,4S,6aR)-4-phenoxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-isoquinolin-1-ylmethanone (PubChem CID 110121460) has the molecular formula C23H22N2O2 and a molecular weight of 358.44 g/mol. Its IUPAC name is [(3aS,4S,6aR)-4-phenoxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-isoquinolin-1-ylmethanone.
| Compound Name | [(3aS,4S,6aR)-4-phenoxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-isoquinolin-1-ylmethanone |
|---|---|
| PubChem CID | 110121460 |
| Molecular Formula | C23H22N2O2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | [(3aS,4S,6aR)-4-phenoxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-isoquinolin-1-ylmethanone |
| SMILES | O=C(c1nccc2ccccc12)N1C[C@@H]2CC[C@H](Oc3ccccc3)[C@@H]2C1 |
| InChI | InChI=1S/C23H22N2O2/c26-23(22-19-9-5-4-6-16(19)12-13-24-22)25-14-17-10-11-21(20(17)15-25)27-18-7-2-1-3-8-18/h1-9,12-13,17,20-21H,10-11,14-15H2/t17-,20+,21-/m0/s1 |
| InChIKey | PTFTWAACSWZBPQ-WMQCIHAUSA-N |
| XLogP | 4.16 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |