C14H14N2O3 — CID 106671738
(3,4-dihydroxypyrrolidin-1-yl)-isoquinolin-1-ylmethanone (PubChem CID 106671738) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is (3,4-dihydroxypyrrolidin-1-yl)-isoquinolin-1-ylmethanone.
| Compound Name | (3,4-dihydroxypyrrolidin-1-yl)-isoquinolin-1-ylmethanone |
|---|---|
| PubChem CID | 106671738 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | (3,4-dihydroxypyrrolidin-1-yl)-isoquinolin-1-ylmethanone |
| SMILES | O=C(c1nccc2ccccc12)N1CC(O)C(O)C1 |
| InChI | InChI=1S/C14H14N2O3/c17-11-7-16(8-12(11)18)14(19)13-10-4-2-1-3-9(10)5-6-15-13/h1-6,11-12,17-18H,7-8H2 |
| InChIKey | IQYLNBAMLJGXRH-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |