C20H16F2N2O — CID 164633243
[(3R)-3-(2,6-difluorophenyl)pyrrolidin-1-yl]-isoquinolin-1-ylmethanone (PubChem CID 164633243) has the molecular formula C20H16F2N2O and a molecular weight of 338.36 g/mol. Its IUPAC name is [(3R)-3-(2,6-difluorophenyl)pyrrolidin-1-yl]-isoquinolin-1-ylmethanone.
| Compound Name | [(3R)-3-(2,6-difluorophenyl)pyrrolidin-1-yl]-isoquinolin-1-ylmethanone |
|---|---|
| PubChem CID | 164633243 |
| Molecular Formula | C20H16F2N2O |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | [(3R)-3-(2,6-difluorophenyl)pyrrolidin-1-yl]-isoquinolin-1-ylmethanone |
| SMILES | O=C(c1nccc2ccccc12)N1CC[C@H](c2c(F)cccc2F)C1 |
| InChI | InChI=1S/C20H16F2N2O/c21-16-6-3-7-17(22)18(16)14-9-11-24(12-14)20(25)19-15-5-2-1-4-13(15)8-10-23-19/h1-8,10,14H,9,11-12H2/t14-/m0/s1 |
| InChIKey | FVGSPCLDRFVFNX-AWEZNQCLSA-N |
| XLogP | 4.14 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |