C15H19Cl2N3O — CID 119413779
isoquinolin-1-yl-[3-(methylamino)pyrrolidin-1-yl]methanone;dihydrochloride (PubChem CID 119413779) has the molecular formula C15H19Cl2N3O and a molecular weight of 328.24 g/mol. Its IUPAC name is isoquinolin-1-yl-[3-(methylamino)pyrrolidin-1-yl]methanone;dihydrochloride.
| Compound Name | isoquinolin-1-yl-[3-(methylamino)pyrrolidin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119413779 |
| Molecular Formula | C15H19Cl2N3O |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | isoquinolin-1-yl-[3-(methylamino)pyrrolidin-1-yl]methanone;dihydrochloride |
| SMILES | CNC1CCN(C(=O)c2nccc3ccccc23)C1.Cl.Cl |
| InChI | InChI=1S/C15H17N3O.2ClH/c1-16-12-7-9-18(10-12)15(19)14-13-5-3-2-4-11(13)6-8-17-14;;/h2-6,8,12,16H,7,9-10H2,1H3;2*1H |
| InChIKey | XEXTYIBMFPQNQJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |