C15H14N2O — CID 141178399
3,6-dihydro-2H-pyridin-1-yl(isoquinolin-1-yl)methanone (PubChem CID 141178399) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is 3,6-dihydro-2H-pyridin-1-yl(isoquinolin-1-yl)methanone.
| Compound Name | 3,6-dihydro-2H-pyridin-1-yl(isoquinolin-1-yl)methanone |
|---|---|
| PubChem CID | 141178399 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 3,6-dihydro-2H-pyridin-1-yl(isoquinolin-1-yl)methanone |
| SMILES | O=C(c1nccc2ccccc12)N1CC=CCC1 |
| InChI | InChI=1S/C15H14N2O/c18-15(17-10-4-1-5-11-17)14-13-7-3-2-6-12(13)8-9-16-14/h1-4,6-9H,5,10-11H2 |
| InChIKey | VMWHROGSWNUEGO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|