C15H13ClN2O — CID 114408574
(4-chloroquinolin-2-yl)-(3,6-dihydro-2H-pyridin-1-yl)methanone (PubChem CID 114408574) has the molecular formula C15H13ClN2O and a molecular weight of 272.74 g/mol. Its IUPAC name is (4-chloroquinolin-2-yl)-(3,6-dihydro-2H-pyridin-1-yl)methanone.
| Compound Name | (4-chloroquinolin-2-yl)-(3,6-dihydro-2H-pyridin-1-yl)methanone |
|---|---|
| PubChem CID | 114408574 |
| Molecular Formula | C15H13ClN2O |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | (4-chloroquinolin-2-yl)-(3,6-dihydro-2H-pyridin-1-yl)methanone |
| SMILES | O=C(c1cc(Cl)c2ccccc2n1)N1CC=CCC1 |
| InChI | InChI=1S/C15H13ClN2O/c16-12-10-14(15(19)18-8-4-1-5-9-18)17-13-7-3-2-6-11(12)13/h1-4,6-7,10H,5,8-9H2 |
| InChIKey | GAUJQVAKPZATTF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|