C14H13N3O — CID 141178404
cinnolin-4-yl(3,6-dihydro-2H-pyridin-1-yl)methanone (PubChem CID 141178404) has the molecular formula C14H13N3O and a molecular weight of 239.28 g/mol. Its IUPAC name is cinnolin-4-yl(3,6-dihydro-2H-pyridin-1-yl)methanone.
| Compound Name | cinnolin-4-yl(3,6-dihydro-2H-pyridin-1-yl)methanone |
|---|---|
| PubChem CID | 141178404 |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | cinnolin-4-yl(3,6-dihydro-2H-pyridin-1-yl)methanone |
| SMILES | O=C(c1cnnc2ccccc12)N1CC=CCC1 |
| InChI | InChI=1S/C14H13N3O/c18-14(17-8-4-1-5-9-17)12-10-15-16-13-7-3-2-6-11(12)13/h1-4,6-7,10H,5,8-9H2 |
| InChIKey | MHLJPGFITDQFGP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|