C24H22N6O — CID 110093698
isoquinolin-1-yl-[3-[6-(pyrazin-2-ylamino)-2-pyridinyl]piperidin-1-yl]methanone (PubChem CID 110093698) has the molecular formula C24H22N6O and a molecular weight of 410.48 g/mol. Its IUPAC name is isoquinolin-1-yl-[3-[6-(pyrazin-2-ylamino)-2-pyridinyl]piperidin-1-yl]methanone.
| Compound Name | isoquinolin-1-yl-[3-[6-(pyrazin-2-ylamino)-2-pyridinyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 110093698 |
| Molecular Formula | C24H22N6O |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | isoquinolin-1-yl-[3-[6-(pyrazin-2-ylamino)-2-pyridinyl]piperidin-1-yl]methanone |
| SMILES | O=C(c1nccc2ccccc12)N1CCCC(c2cccc(Nc3cnccn3)n2)C1 |
| InChI | InChI=1S/C24H22N6O/c31-24(23-19-7-2-1-5-17(19)10-11-27-23)30-14-4-6-18(16-30)20-8-3-9-21(28-20)29-22-15-25-12-13-26-22/h1-3,5,7-13,15,18H,4,6,14,16H2,(H,26,28,29) |
| InChIKey | BQYXYKSQPAHWDS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |