C15H19N7O — CID 95842808
2-amino-1-[(3S)-3-[2-(pyrazin-2-ylamino)pyrimidin-4-yl]piperidin-1-yl]ethanone (PubChem CID 95842808) has the molecular formula C15H19N7O and a molecular weight of 313.37 g/mol. Its IUPAC name is 2-amino-1-[(3S)-3-[2-(pyrazin-2-ylamino)pyrimidin-4-yl]piperidin-1-yl]ethanone.
| Compound Name | 2-amino-1-[(3S)-3-[2-(pyrazin-2-ylamino)pyrimidin-4-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 95842808 |
| Molecular Formula | C15H19N7O |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 2-amino-1-[(3S)-3-[2-(pyrazin-2-ylamino)pyrimidin-4-yl]piperidin-1-yl]ethanone |
| SMILES | NCC(=O)N1CCC[C@H](c2ccnc(Nc3cnccn3)n2)C1 |
| InChI | InChI=1S/C15H19N7O/c16-8-14(23)22-7-1-2-11(10-22)12-3-4-19-15(20-12)21-13-9-17-5-6-18-13/h3-6,9,11H,1-2,7-8,10,16H2,(H,18,19,20,21)/t11-/m0/s1 |
| InChIKey | BCQDGCGAPCYINB-NSHDSACASA-N |
| XLogP | 0.67 |
| TPSA | 109.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |