C16H21N7O — CID 95842844
2-(methylamino)-1-[(3S)-3-[2-(pyrazin-2-ylamino)pyrimidin-4-yl]piperidin-1-yl]ethanone (PubChem CID 95842844) has the molecular formula C16H21N7O and a molecular weight of 327.39 g/mol. Its IUPAC name is 2-(methylamino)-1-[(3S)-3-[2-(pyrazin-2-ylamino)pyrimidin-4-yl]piperidin-1-yl]ethanone.
| Compound Name | 2-(methylamino)-1-[(3S)-3-[2-(pyrazin-2-ylamino)pyrimidin-4-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 95842844 |
| Molecular Formula | C16H21N7O |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 2-(methylamino)-1-[(3S)-3-[2-(pyrazin-2-ylamino)pyrimidin-4-yl]piperidin-1-yl]ethanone |
| SMILES | CNCC(=O)N1CCC[C@H](c2ccnc(Nc3cnccn3)n2)C1 |
| InChI | InChI=1S/C16H21N7O/c1-17-10-15(24)23-8-2-3-12(11-23)13-4-5-20-16(21-13)22-14-9-18-6-7-19-14/h4-7,9,12,17H,2-3,8,10-11H2,1H3,(H,19,20,21,22)/t12-/m0/s1 |
| InChIKey | CXPHLVUDAWJVRZ-LBPRGKRZSA-N |
| XLogP | 0.94 |
| TPSA | 95.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |