C20H20N6O — CID 110094434
phenyl-[4-[2-(pyrazin-2-ylamino)pyrimidin-4-yl]piperidin-1-yl]methanone (PubChem CID 110094434) has the molecular formula C20H20N6O and a molecular weight of 360.42 g/mol. Its IUPAC name is phenyl-[4-[2-(pyrazin-2-ylamino)pyrimidin-4-yl]piperidin-1-yl]methanone.
| Compound Name | phenyl-[4-[2-(pyrazin-2-ylamino)pyrimidin-4-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 110094434 |
| Molecular Formula | C20H20N6O |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | phenyl-[4-[2-(pyrazin-2-ylamino)pyrimidin-4-yl]piperidin-1-yl]methanone |
| SMILES | O=C(c1ccccc1)N1CCC(c2ccnc(Nc3cnccn3)n2)CC1 |
| InChI | InChI=1S/C20H20N6O/c27-19(16-4-2-1-3-5-16)26-12-7-15(8-13-26)17-6-9-23-20(24-17)25-18-14-21-10-11-22-18/h1-6,9-11,14-15H,7-8,12-13H2,(H,22,23,24,25) |
| InChIKey | AYMKYMQIXROSPA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |